C5H8FN3OS — CID 137190981
3-(3-fluoropropylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137190981) has the molecular formula C5H8FN3OS and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-(3-fluoropropylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(3-fluoropropylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137190981 |
| Molecular Formula | C5H8FN3OS |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-(3-fluoropropylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(SCCCF)[nH]1 |
| InChI | InChI=1S/C5H8FN3OS/c6-2-1-3-11-5-7-4(10)8-9-5/h1-3H2,(H2,7,8,9,10) |
| InChIKey | MHMGMNKHUYCTBF-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|