C17H10F3NO — CID 137192686
1-[(1Z,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-3-yl]-2,2,2-trifluoroethanone (PubChem CID 137192686) has the molecular formula C17H10F3NO and a molecular weight of 301.27 g/mol. Its IUPAC name is 1-[(1Z,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1Z,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 137192686 |
| Molecular Formula | C17H10F3NO |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[(1Z,9Z,11Z)-8-azatricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaen-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cccc2/c1=c1/cccc/c1=C/C=C\N=2)C(F)(F)F |
| InChI | InChI=1S/C17H10F3NO/c18-17(19,20)16(22)13-8-3-9-14-15(13)12-7-2-1-5-11(12)6-4-10-21-14/h1-10H/b6-4-,10-4-,11-6-,15-12-,21-10-,21-14- |
| InChIKey | YAKNVCOJKUIMOL-MZVWPJDPSA-N |
| XLogP | 2.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |