About 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate
5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate (PubChem CID 137192707) has the molecular formula C9H13N3O3
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate.
Molecular Properties
| Compound Name | 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate |
| PubChem CID | 137192707 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate |
| SMILES | CCON1CC(O)=Cc2ncncc21.O |
| InChI | InChI=1S/C9H11N3O2.H2O/c1-2-14-12-5-7(13)3-8-9(12)4-10-6-11-8;/h3-4,6,13H,2,5H2,1H3;1H2 |
| InChIKey | NWSHJSRMGMUUSY-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 89.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate?
The IUPAC name of 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate (CID 137192707) is 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate.
What is the SMILES notation for 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate?
The canonical SMILES for 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate is CCON1CC(O)=Cc2ncncc21.O.
What is the InChIKey of 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate?
The InChIKey is NWSHJSRMGMUUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2.H2O/c1-2-14-12-5-7(13)3-8-9(12)4-10-6-11-8;/h3-4,6,13H,2,5H2,1H3;1H2.
What are the key properties of 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate?
5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate has a molecular weight of 211.22 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-6H-pyrido[3,2-d]pyrimidin-7-ol;hydrate is sourced from PubChem (CID 137192707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).