About phthalazine-5,6-diol
phthalazine-5,6-diol (PubChem CID 137192823) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is phthalazine-5,6-diol.
Molecular Properties
| Compound Name | phthalazine-5,6-diol |
| PubChem CID | 137192823 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | phthalazine-5,6-diol |
| SMILES | Oc1ccc2cnncc2c1O |
| InChI | InChI=1S/C8H6N2O2/c11-7-2-1-5-3-9-10-4-6(5)8(7)12/h1-4,11-12H |
| InChIKey | BVWQZTCPONXVHO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze phthalazine-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine-5,6-diol?
The IUPAC name of phthalazine-5,6-diol (CID 137192823) is phthalazine-5,6-diol.
What is the SMILES notation for phthalazine-5,6-diol?
The canonical SMILES for phthalazine-5,6-diol is Oc1ccc2cnncc2c1O.
What is the InChIKey of phthalazine-5,6-diol?
The InChIKey is BVWQZTCPONXVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c11-7-2-1-5-3-9-10-4-6(5)8(7)12/h1-4,11-12H.
What are the key properties of phthalazine-5,6-diol?
phthalazine-5,6-diol has a molecular weight of 162.15 g/mol, XLogP of 1.04, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine-5,6-diol is sourced from PubChem (CID 137192823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).