C33H33FN2O2 — CID 137194205
5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-quinolin-5-yl-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 137194205) has the molecular formula C33H33FN2O2 and a molecular weight of 508.64 g/mol. Its IUPAC name is 5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-quinolin-5-yl-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-quinolin-5-yl-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 137194205 |
| Molecular Formula | C33H33FN2O2 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-quinolin-5-yl-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | Oc1ccc2c(c1)CCCC(c1cccc3ncccc13)=C2c1ccc(O[C@H]2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C33H33FN2O2/c34-17-4-19-36-20-16-27(22-36)38-26-13-10-23(11-14-26)33-28-15-12-25(37)21-24(28)5-1-7-31(33)29-6-2-9-32-30(29)8-3-18-35-32/h2-3,6,8-15,18,21,27,37H,1,4-5,7,16-17,19-20,22H2/t27-/m0/s1 |
| InChIKey | KOJXZNCKTBXCGS-MHZLTWQESA-N |
| XLogP | 7.05 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|