C9H11N3O2 — CID 137194912
ethyl 1-methyl-4H-pyrrolo[2,3-d]pyrazole-5-carboxylate (PubChem CID 137194912) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is ethyl 1-methyl-4H-pyrrolo[2,3-d]pyrazole-5-carboxylate.
| Compound Name | ethyl 1-methyl-4H-pyrrolo[2,3-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 137194912 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | ethyl 1-methyl-4H-pyrrolo[2,3-d]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cnn2C)[nH]1 |
| InChI | InChI=1S/C9H11N3O2/c1-3-14-9(13)6-4-8-7(11-6)5-10-12(8)2/h4-5,11H,3H2,1-2H3 |
| InChIKey | PXOGVQYAJQCHCB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |