About 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione
5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione (PubChem CID 137195872) has the molecular formula C7H7N5S
and a molecular weight of 193.24 g/mol. Its IUPAC name is 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione.
Molecular Properties
| Compound Name | 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione |
| PubChem CID | 137195872 |
| Molecular Formula | C7H7N5S |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione |
| SMILES | Cn1ncnc1-c1c[nH]c(=S)cn1 |
| InChI | InChI=1S/C7H7N5S/c1-12-7(10-4-11-12)5-2-9-6(13)3-8-5/h2-4H,1H3,(H,9,13) |
| InChIKey | OGDCXOYFJUUQQE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione?
The IUPAC name of 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione (CID 137195872) is 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione.
What is the SMILES notation for 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione?
The canonical SMILES for 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione is Cn1ncnc1-c1c[nH]c(=S)cn1.
What is the InChIKey of 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione?
The InChIKey is OGDCXOYFJUUQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5S/c1-12-7(10-4-11-12)5-2-9-6(13)3-8-5/h2-4H,1H3,(H,9,13).
What are the key properties of 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione?
5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione has a molecular weight of 193.24 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,2,4-triazol-3-yl)-1H-pyrazine-2-thione is sourced from PubChem (CID 137195872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).