About 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride
5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride (PubChem CID 137195894) has the molecular formula C13H21ClN4O
and a molecular weight of 284.79 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride |
| PubChem CID | 137195894 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride |
| SMILES | CCn1nc(C)c2c(=O)c(CN(C)C)c(C)[nH]c21.Cl |
| InChI | InChI=1S/C13H20N4O.ClH/c1-6-17-13-11(9(3)15-17)12(18)10(7-16(4)5)8(2)14-13;/h6-7H2,1-5H3,(H,14,18);1H |
| InChIKey | HYTXEXJMDWSJIB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride?
The IUPAC name of 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride (CID 137195894) is 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride.
What is the SMILES notation for 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride?
The canonical SMILES for 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride is CCn1nc(C)c2c(=O)c(CN(C)C)c(C)[nH]c21.Cl.
What is the InChIKey of 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride?
The InChIKey is HYTXEXJMDWSJIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O.ClH/c1-6-17-13-11(9(3)15-17)12(18)10(7-16(4)5)8(2)14-13;/h6-7H2,1-5H3,(H,14,18);1H.
What are the key properties of 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride?
5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride has a molecular weight of 284.79 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(dimethylamino)methyl]-1-ethyl-3,6-dimethyl-7H-pyrazolo[5,4-b]pyridin-4-one;hydrochloride is sourced from PubChem (CID 137195894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).