About 2-cyclopenta-1,4-dien-1-yloxyacetic acid
2-cyclopenta-1,4-dien-1-yloxyacetic acid (PubChem CID 137195901) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-yloxyacetic acid.
Molecular Properties
| Compound Name | 2-cyclopenta-1,4-dien-1-yloxyacetic acid |
| PubChem CID | 137195901 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-yloxyacetic acid |
| SMILES | O=C(O)COC1=CCC=C1 |
| InChI | InChI=1S/C7H8O3/c8-7(9)5-10-6-3-1-2-4-6/h1,3-4H,2,5H2,(H,8,9) |
| InChIKey | SROKIFAFGAYRPR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopenta-1,4-dien-1-yloxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-1,4-dien-1-yloxyacetic acid?
The IUPAC name of 2-cyclopenta-1,4-dien-1-yloxyacetic acid (CID 137195901) is 2-cyclopenta-1,4-dien-1-yloxyacetic acid.
What is the SMILES notation for 2-cyclopenta-1,4-dien-1-yloxyacetic acid?
The canonical SMILES for 2-cyclopenta-1,4-dien-1-yloxyacetic acid is O=C(O)COC1=CCC=C1.
What is the InChIKey of 2-cyclopenta-1,4-dien-1-yloxyacetic acid?
The InChIKey is SROKIFAFGAYRPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-7(9)5-10-6-3-1-2-4-6/h1,3-4H,2,5H2,(H,8,9).
What are the key properties of 2-cyclopenta-1,4-dien-1-yloxyacetic acid?
2-cyclopenta-1,4-dien-1-yloxyacetic acid has a molecular weight of 140.14 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-1,4-dien-1-yloxyacetic acid is sourced from PubChem (CID 137195901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).