C22H28FN5O — CID 137196767
7-cyclohexyl-2-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azetidin-1-yl]methyl]-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 137196767) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is 7-cyclohexyl-2-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azetidin-1-yl]methyl]-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 7-cyclohexyl-2-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azetidin-1-yl]methyl]-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 137196767 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 7-cyclohexyl-2-[[3-[(1E,3E,5Z)-4-fluorohepta-1,3,5-trienyl]azetidin-1-yl]methyl]-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | C/C=C\C(F)=C/C=C/C1CN(Cc2nn3c(C4CCCCC4)ncc3c(=O)[nH]2)C1 |
| InChI | InChI=1S/C22H28FN5O/c1-2-7-18(23)11-6-8-16-13-27(14-16)15-20-25-22(29)19-12-24-21(28(19)26-20)17-9-4-3-5-10-17/h2,6-8,11-12,16-17H,3-5,9-10,13-15H2,1H3,(H,25,26,29)/b7-2-,8-6+,18-11+ |
| InChIKey | YRQOBYLRZVMEDZ-HHZCAIAFSA-N |
| XLogP | 3.88 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|