About 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea
1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea (PubChem CID 137196961) has the molecular formula C16H13Cl2N5O3S2
and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea.
Molecular Properties
| Compound Name | 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
| PubChem CID | 137196961 |
| Molecular Formula | C16H13Cl2N5O3S2 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea |
| SMILES | Cn1c(O)c(/N=N/C(=S)Nc2cccc(S(N)(=O)=O)c2)c2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C16H13Cl2N5O3S2/c1-23-14-11(5-8(17)6-12(14)18)13(15(23)24)21-22-16(27)20-9-3-2-4-10(7-9)28(19,25)26/h2-7,24H,1H3,(H,20,27)(H2,19,25,26)/b22-21+ |
| InChIKey | DXQTXUZRGBSVKC-QURGRASLSA-N |
| XLogP | 4.32 |
| TPSA | 122.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea?
The IUPAC name of 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea (CID 137196961) is 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea.
What is the SMILES notation for 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea?
The canonical SMILES for 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea is Cn1c(O)c(/N=N/C(=S)Nc2cccc(S(N)(=O)=O)c2)c2cc(Cl)cc(Cl)c21.
What is the InChIKey of 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea?
The InChIKey is DXQTXUZRGBSVKC-QURGRASLSA-N. The full InChI is InChI=1S/C16H13Cl2N5O3S2/c1-23-14-11(5-8(17)6-12(14)18)13(15(23)24)21-22-16(27)20-9-3-2-4-10(7-9)28(19,25)26/h2-7,24H,1H3,(H,20,27)(H2,19,25,26)/b22-21+.
What are the key properties of 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea?
1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea has a molecular weight of 458.35 g/mol, XLogP of 4.32, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-dichloro-2-hydroxy-1-methylindol-3-yl)imino-3-(3-sulfamoylphenyl)thiourea is sourced from PubChem (CID 137196961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).