C22H30N4O2S — CID 137197296
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 3,6-dihydroxynaphthalene-2-carboximidothioate (PubChem CID 137197296) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 3,6-dihydroxynaphthalene-2-carboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 3,6-dihydroxynaphthalene-2-carboximidothioate |
|---|---|
| PubChem CID | 137197296 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 3,6-dihydroxynaphthalene-2-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])N(C)C1CC(C)(C)NC(C)(C)C1)c1cc2ccc(O)cc2cc1O |
| InChI | InChI=1S/C22H30N4O2S/c1-21(2)11-15(12-22(3,4)25-21)26(5)20(24)29-19(23)17-9-13-6-7-16(27)8-14(13)10-18(17)28/h6-10,15,23-25,27-28H,11-12H2,1-5H3/b23-19-,24-20+ |
| InChIKey | WZLQWLDZVHPUEE-KDMDJZHMSA-N |
| XLogP | 4.49 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|