C28H31N3O5S — CID 137197751
5,7-dimethoxy-2-[3-(4-methoxysulfanylphenyl)-4-[2-(propan-2-ylamino)ethoxy]phenyl]-3H-quinazolin-4-one (PubChem CID 137197751) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is 5,7-dimethoxy-2-[3-(4-methoxysulfanylphenyl)-4-[2-(propan-2-ylamino)ethoxy]phenyl]-3H-quinazolin-4-one.
| Compound Name | 5,7-dimethoxy-2-[3-(4-methoxysulfanylphenyl)-4-[2-(propan-2-ylamino)ethoxy]phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137197751 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 5,7-dimethoxy-2-[3-(4-methoxysulfanylphenyl)-4-[2-(propan-2-ylamino)ethoxy]phenyl]-3H-quinazolin-4-one |
| SMILES | COSc1ccc(-c2cc(-c3nc4cc(OC)cc(OC)c4c(=O)[nH]3)ccc2OCCNC(C)C)cc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-17(2)29-12-13-36-24-11-8-19(14-22(24)18-6-9-21(10-7-18)37-35-5)27-30-23-15-20(33-3)16-25(34-4)26(23)28(32)31-27/h6-11,14-17,29H,12-13H2,1-5H3,(H,30,31,32) |
| InChIKey | GYHOXIRCNURVIY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|