C12H17N3O3 — CID 137198209
butyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate (PubChem CID 137198209) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is butyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate.
| Compound Name | butyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 137198209 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | butyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-7-carboxylate |
| SMILES | CCCCOC(=O)N1CCc2c(nc[nH]c2=O)C1 |
| InChI | InChI=1S/C12H17N3O3/c1-2-3-6-18-12(17)15-5-4-9-10(7-15)13-8-14-11(9)16/h8H,2-7H2,1H3,(H,13,14,16) |
| InChIKey | UCTRTUBHNXYUMZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|