C11H17N5O2 — CID 137199083
2-amino-9-(3,5-dimethyloxolan-2-yl)-7,8-dihydro-1H-purin-6-one (PubChem CID 137199083) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-amino-9-(3,5-dimethyloxolan-2-yl)-7,8-dihydro-1H-purin-6-one.
| Compound Name | 2-amino-9-(3,5-dimethyloxolan-2-yl)-7,8-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 137199083 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-amino-9-(3,5-dimethyloxolan-2-yl)-7,8-dihydro-1H-purin-6-one |
| SMILES | CC1CC(C)C(N2CNc3c2nc(N)[nH]c3=O)O1 |
| InChI | InChI=1S/C11H17N5O2/c1-5-3-6(2)18-10(5)16-4-13-7-8(16)14-11(12)15-9(7)17/h5-6,10,13H,3-4H2,1-2H3,(H3,12,14,15,17) |
| InChIKey | YCKHTLBZFLDLCG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |