C14H17FN4 — CID 137199184
(3E,5E)-5-fluoro-2-(5-methyl-6,7-dihydro-2H-pyrazolo[3,4-b]pyridin-3-yl)hepta-1,3,5-trien-4-amine (PubChem CID 137199184) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is (3E,5E)-5-fluoro-2-(5-methyl-6,7-dihydro-2H-pyrazolo[3,4-b]pyridin-3-yl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-5-fluoro-2-(5-methyl-6,7-dihydro-2H-pyrazolo[3,4-b]pyridin-3-yl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 137199184 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (3E,5E)-5-fluoro-2-(5-methyl-6,7-dihydro-2H-pyrazolo[3,4-b]pyridin-3-yl)hepta-1,3,5-trien-4-amine |
| SMILES | C=C(/C=C(N)\C(F)=C/C)c1[nH]nc2c1C=C(C)CN2 |
| InChI | InChI=1S/C14H17FN4/c1-4-11(15)12(16)6-9(3)13-10-5-8(2)7-17-14(10)19-18-13/h4-6H,3,7,16H2,1-2H3,(H2,17,18,19)/b11-4+,12-6+ |
| InChIKey | ZYLQBGBAUQSRNL-RYYWOMKVSA-N |
| XLogP | 2.97 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|