C6H7N5O3S — CID 137199499
1-methyl-1-[(4,5,6-trioxo-1,3-diazinan-2-ylidene)amino]thiourea (PubChem CID 137199499) has the molecular formula C6H7N5O3S and a molecular weight of 229.22 g/mol. Its IUPAC name is 1-methyl-1-[(4,5,6-trioxo-1,3-diazinan-2-ylidene)amino]thiourea.
| Compound Name | 1-methyl-1-[(4,5,6-trioxo-1,3-diazinan-2-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 137199499 |
| Molecular Formula | C6H7N5O3S |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 1-methyl-1-[(4,5,6-trioxo-1,3-diazinan-2-ylidene)amino]thiourea |
| SMILES | CN(N=C1NC(=O)C(=O)C(=O)N1)C(N)=S |
| InChI | InChI=1S/C6H7N5O3S/c1-11(5(7)15)10-6-8-3(13)2(12)4(14)9-6/h1H3,(H2,7,15)(H2,8,9,10,13,14) |
| InChIKey | QJDJNWVKWZGLGX-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|