C11H12N4S — CID 137199572
2-(4-amino-6-methyl-1,3,5-triazin-2-yl)-5-methylbenzenethiol (PubChem CID 137199572) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)-5-methylbenzenethiol.
| Compound Name | 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)-5-methylbenzenethiol |
|---|---|
| PubChem CID | 137199572 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-(4-amino-6-methyl-1,3,5-triazin-2-yl)-5-methylbenzenethiol |
| SMILES | Cc1ccc(-c2nc(C)nc(N)n2)c(S)c1 |
| InChI | InChI=1S/C11H12N4S/c1-6-3-4-8(9(16)5-6)10-13-7(2)14-11(12)15-10/h3-5,16H,1-2H3,(H2,12,13,14,15) |
| InChIKey | JYASEOZAVLAYQK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|