C13H10N4O4S — CID 137200096
6-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1-methyl-8H-pteridine-2,4,7-trione (PubChem CID 137200096) has the molecular formula C13H10N4O4S and a molecular weight of 318.31 g/mol. Its IUPAC name is 6-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1-methyl-8H-pteridine-2,4,7-trione.
| Compound Name | 6-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1-methyl-8H-pteridine-2,4,7-trione |
|---|---|
| PubChem CID | 137200096 |
| Molecular Formula | C13H10N4O4S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 6-[(Z)-2-hydroxy-2-thiophen-2-ylethenyl]-1-methyl-8H-pteridine-2,4,7-trione |
| SMILES | Cn1c(=O)[nH]c(=O)c2nc(/C=C(\O)c3cccs3)c(=O)[nH]c21 |
| InChI | InChI=1S/C13H10N4O4S/c1-17-10-9(12(20)16-13(17)21)14-6(11(19)15-10)5-7(18)8-3-2-4-22-8/h2-5,18H,1H3,(H,15,19)(H,16,20,21)/b7-5- |
| InChIKey | JOJQXGNSQCVEDO-ALCCZGGFSA-N |
| XLogP | 0.43 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|