C13H20N4 — CID 137200370
(3E,7E)-3,15-dimethyl-2,9,14,15-tetrazabicyclo[10.3.0]pentadeca-1(12),3,7,13-tetraene (PubChem CID 137200370) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is (3E,7E)-3,15-dimethyl-2,9,14,15-tetrazabicyclo[10.3.0]pentadeca-1(12),3,7,13-tetraene.
| Compound Name | (3E,7E)-3,15-dimethyl-2,9,14,15-tetrazabicyclo[10.3.0]pentadeca-1(12),3,7,13-tetraene |
|---|---|
| PubChem CID | 137200370 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | (3E,7E)-3,15-dimethyl-2,9,14,15-tetrazabicyclo[10.3.0]pentadeca-1(12),3,7,13-tetraene |
| SMILES | C/C1=C\CC/C=C/NCCc2cnn(C)c2N1 |
| InChI | InChI=1S/C13H20N4/c1-11-6-4-3-5-8-14-9-7-12-10-15-17(2)13(12)16-11/h5-6,8,10,14,16H,3-4,7,9H2,1-2H3/b8-5+,11-6+ |
| InChIKey | ZFUVKJICGCWTAW-XSIURBDDSA-N |
| XLogP | 2.18 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |