About 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea
1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea (PubChem CID 137202444) has the molecular formula C5H9N5O3
and a molecular weight of 187.16 g/mol. Its IUPAC name is 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea |
| PubChem CID | 137202444 |
| Molecular Formula | C5H9N5O3 |
| Molecular Weight | 187.16 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea |
| SMILES | NNC(=O)NCCc1noc(=O)[nH]1 |
| InChI | InChI=1S/C5H9N5O3/c6-9-4(11)7-2-1-3-8-5(12)13-10-3/h1-2,6H2,(H2,7,9,11)(H,8,10,12) |
| InChIKey | JWIRUISEQZLADS-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.16 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea?
The IUPAC name of 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea (CID 137202444) is 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea.
What is the SMILES notation for 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea?
The canonical SMILES for 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea is NNC(=O)NCCc1noc(=O)[nH]1.
What is the InChIKey of 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea?
The InChIKey is JWIRUISEQZLADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O3/c6-9-4(11)7-2-1-3-8-5(12)13-10-3/h1-2,6H2,(H2,7,9,11)(H,8,10,12).
What are the key properties of 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea?
1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea has a molecular weight of 187.16 g/mol, XLogP of -1.92, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)ethyl]urea is sourced from PubChem (CID 137202444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).