About (6E)-2-diazonona-6,8-dien-3-one
(6E)-2-diazonona-6,8-dien-3-one (PubChem CID 137202614) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is (6E)-2-diazonona-6,8-dien-3-one.
Molecular Properties
| Compound Name | (6E)-2-diazonona-6,8-dien-3-one |
| PubChem CID | 137202614 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (6E)-2-diazonona-6,8-dien-3-one |
| SMILES | C=C/C=C/CCC(=O)C(C)=[N+]=[N-] |
| InChI | InChI=1S/C9H12N2O/c1-3-4-5-6-7-9(12)8(2)11-10/h3-5H,1,6-7H2,2H3/b5-4+ |
| InChIKey | CUKILKNVUNFTDQ-SNAWJCMRSA-N |
| XLogP | 1.77 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6E)-2-diazonona-6,8-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-2-diazonona-6,8-dien-3-one?
The IUPAC name of (6E)-2-diazonona-6,8-dien-3-one (CID 137202614) is (6E)-2-diazonona-6,8-dien-3-one.
What is the SMILES notation for (6E)-2-diazonona-6,8-dien-3-one?
The canonical SMILES for (6E)-2-diazonona-6,8-dien-3-one is C=C/C=C/CCC(=O)C(C)=[N+]=[N-].
What is the InChIKey of (6E)-2-diazonona-6,8-dien-3-one?
The InChIKey is CUKILKNVUNFTDQ-SNAWJCMRSA-N. The full InChI is InChI=1S/C9H12N2O/c1-3-4-5-6-7-9(12)8(2)11-10/h3-5H,1,6-7H2,2H3/b5-4+.
What are the key properties of (6E)-2-diazonona-6,8-dien-3-one?
(6E)-2-diazonona-6,8-dien-3-one has a molecular weight of 164.21 g/mol, XLogP of 1.77, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-2-diazonona-6,8-dien-3-one is sourced from PubChem (CID 137202614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).