C15H20N6O3 — CID 137203092
N'-hydroxy-4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazole-6-carboximidamide (PubChem CID 137203092) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is N'-hydroxy-4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazole-6-carboximidamide.
| Compound Name | N'-hydroxy-4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazole-6-carboximidamide |
|---|---|
| PubChem CID | 137203092 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N'-hydroxy-4-[3-(morpholin-4-ylmethyl)azetidin-1-yl]-2,1,3-benzoxadiazole-6-carboximidamide |
| SMILES | N/C(=N\O)c1cc(N2CC(CN3CCOCC3)C2)c2nonc2c1 |
| InChI | InChI=1S/C15H20N6O3/c16-15(17-22)11-5-12-14(19-24-18-12)13(6-11)21-8-10(9-21)7-20-1-3-23-4-2-20/h5-6,10,22H,1-4,7-9H2,(H2,16,17) |
| InChIKey | UIEPMKSWHRXKKP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|