C42H18F10N6 — CID 137203334
5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-2-yl-21,23-dihydroporphyrin (PubChem CID 137203334) has the molecular formula C42H18F10N6 and a molecular weight of 796.63 g/mol. Its IUPAC name is 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-2-yl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-2-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137203334 |
| Molecular Formula | C42H18F10N6 |
| Molecular Weight | 796.63 g/mol |
| Exact Mass | 796.14 |
| IUPAC Name | 5,15-bis(2,3,4,5,6-pentafluorophenyl)-10,20-dipyridin-2-yl-21,23-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4ccccn4)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5ccccn5)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C42H18F10N6/c43-33-31(34(44)38(48)41(51)37(33)47)29-23-11-7-19(55-23)27(17-5-1-3-15-53-17)20-8-12-24(56-20)30(32-35(45)39(49)42(52)40(50)36(32)46)26-14-10-22(58-26)28(18-6-2-4-16-54-18)21-9-13-25(29)57-21/h1-16,55,58H/b27-19-,27-20-,28-21-,28-22-,29-23+,29-25+,30-24+,30-26+ |
| InChIKey | AXQRNTJVFICAHP-CGKSMUEBSA-N |
| XLogP | 11.50 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.63 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|