C19H26FN3O2 — CID 137203627
ethyl 5-[(3E,5Z)-7-fluorohepta-1,3,5-trien-3-yl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 137203627) has the molecular formula C19H26FN3O2 and a molecular weight of 347.43 g/mol. Its IUPAC name is ethyl 5-[(3E,5Z)-7-fluorohepta-1,3,5-trien-3-yl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-[(3E,5Z)-7-fluorohepta-1,3,5-trien-3-yl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 137203627 |
| Molecular Formula | C19H26FN3O2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethyl 5-[(3E,5Z)-7-fluorohepta-1,3,5-trien-3-yl]-2,7,7-trimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | C=C/C(=C\C=C/CF)C1CC(C)(C)n2nc(C)c(C(=O)OCC)c2N1 |
| InChI | InChI=1S/C19H26FN3O2/c1-6-14(10-8-9-11-20)15-12-19(4,5)23-17(21-15)16(13(3)22-23)18(24)25-7-2/h6,8-10,15,21H,1,7,11-12H2,2-5H3/b9-8-,14-10+ |
| InChIKey | SZDAJGHWJRFJGJ-MYSCJDEHSA-N |
| XLogP | 3.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|