C20H28FN3O2 — CID 137203628
ethyl 7-ethyl-5-[(1E,3Z,5E)-5-fluorohepta-1,3,5-trienyl]-2,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 137203628) has the molecular formula C20H28FN3O2 and a molecular weight of 361.46 g/mol. Its IUPAC name is ethyl 7-ethyl-5-[(1E,3Z,5E)-5-fluorohepta-1,3,5-trienyl]-2,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 7-ethyl-5-[(1E,3Z,5E)-5-fluorohepta-1,3,5-trienyl]-2,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 137203628 |
| Molecular Formula | C20H28FN3O2 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethyl 7-ethyl-5-[(1E,3Z,5E)-5-fluorohepta-1,3,5-trienyl]-2,7-dimethyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | C/C=C(F)\C=C/C=C/C1CC(C)(CC)n2nc(C)c(C(=O)OCC)c2N1 |
| InChI | InChI=1S/C20H28FN3O2/c1-6-15(21)11-9-10-12-16-13-20(5,7-2)24-18(22-16)17(14(4)23-24)19(25)26-8-3/h6,9-12,16,22H,7-8,13H2,1-5H3/b11-9-,12-10+,15-6+ |
| InChIKey | SCUGFGMXEWHFBH-FBGCJQTQSA-N |
| XLogP | 4.66 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|