C21H25N3O — CID 137203655
[7-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanol (PubChem CID 137203655) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is [7-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanol.
| Compound Name | [7-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanol |
|---|---|
| PubChem CID | 137203655 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | [7-[(3Z,5Z)-2-methylidenehepta-3,5-dienyl]-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]methanol |
| SMILES | C=C(/C=C\C=C/C)CC1CC(c2ccccc2)Nc2c(CO)cnn21 |
| InChI | InChI=1S/C21H25N3O/c1-3-4-6-9-16(2)12-19-13-20(17-10-7-5-8-11-17)23-21-18(15-25)14-22-24(19)21/h3-11,14,19-20,23,25H,2,12-13,15H2,1H3/b4-3-,9-6- |
| InChIKey | PCKMCYIYOOVHFW-UBCGXMOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|