C19H27N3O — CID 137203656
1-[(6R)-6-cyclohepta-1,6-dien-1-yl-8,8-dimethyl-5,6,7,9-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazocin-3-yl]ethanone (PubChem CID 137203656) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-[(6R)-6-cyclohepta-1,6-dien-1-yl-8,8-dimethyl-5,6,7,9-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazocin-3-yl]ethanone.
| Compound Name | 1-[(6R)-6-cyclohepta-1,6-dien-1-yl-8,8-dimethyl-5,6,7,9-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazocin-3-yl]ethanone |
|---|---|
| PubChem CID | 137203656 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-[(6R)-6-cyclohepta-1,6-dien-1-yl-8,8-dimethyl-5,6,7,9-tetrahydro-4H-pyrazolo[1,5-a][1,3]diazocin-3-yl]ethanone |
| SMILES | CC(=O)c1cnn2c1NC[C@@H](C1=CCCCC=C1)CC(C)(C)C2 |
| InChI | InChI=1S/C19H27N3O/c1-14(23)17-12-21-22-13-19(2,3)10-16(11-20-18(17)22)15-8-6-4-5-7-9-15/h6,8-9,12,16,20H,4-5,7,10-11,13H2,1-3H3/t16-/m0/s1 |
| InChIKey | GQWMUGTXVQDNNC-INIZCTEOSA-N |
| XLogP | 4.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |