C17H25N3O2 — CID 137203660
7,7-diethyl-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 137203660) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 7,7-diethyl-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 7,7-diethyl-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 137203660 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 7,7-diethyl-5-[(2E,4Z)-hexa-2,4-dien-3-yl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | C/C=C\C(=C/C)C1CC(CC)(CC)n2ncc(C(=O)O)c2N1 |
| InChI | InChI=1S/C17H25N3O2/c1-5-9-12(6-2)14-10-17(7-3,8-4)20-15(19-14)13(11-18-20)16(21)22/h5-6,9,11,14,19H,7-8,10H2,1-4H3,(H,21,22)/b9-5-,12-6+ |
| InChIKey | LDTVJHOOTCWHBX-JBSCERNYSA-N |
| XLogP | 3.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|