C19H22F2N4O3S — CID 137203661
[7-(1,1-difluoroethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone (PubChem CID 137203661) has the molecular formula C19H22F2N4O3S and a molecular weight of 424.47 g/mol. Its IUPAC name is [7-(1,1-difluoroethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | [7-(1,1-difluoroethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 137203661 |
| Molecular Formula | C19H22F2N4O3S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [7-(1,1-difluoroethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-(1,1-dioxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC(F)(F)C1CC(c2ccccc2)Nc2c(C(=O)N3CCS(=O)(=O)CC3)cnn21 |
| InChI | InChI=1S/C19H22F2N4O3S/c1-19(20,21)16-11-15(13-5-3-2-4-6-13)23-17-14(12-22-25(16)17)18(26)24-7-9-29(27,28)10-8-24/h2-6,12,15-16,23H,7-11H2,1H3 |
| InChIKey | VHLJREOFQRFAQU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |