C19H27N3O — CID 137203672
1-[(5R)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone (PubChem CID 137203672) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-[(5R)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone.
| Compound Name | 1-[(5R)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone |
|---|---|
| PubChem CID | 137203672 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-[(5R)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,7,7-trimethyl-4,5,6,8-tetrahydropyrazolo[1,5-a][1,3]diazepin-3-yl]ethanone |
| SMILES | C=C/C=C(\C=C/C)[C@H]1CC(C)(C)Cn2nc(C)c(C(C)=O)c2N1 |
| InChI | InChI=1S/C19H27N3O/c1-7-9-15(10-8-2)16-11-19(5,6)12-22-18(20-16)17(14(4)23)13(3)21-22/h7-10,16,20H,1,11-12H2,2-6H3/b10-8-,15-9+/t16-/m1/s1 |
| InChIKey | IBCQOSZWWFYLMG-GKWCNAIASA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|