C17H20F3N3O2 — CID 137203710
5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 137203710) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is 5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 137203710 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 5-[(3E,5Z)-nona-1,3,5-trien-4-yl]-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C/CCC)C1CC(C(F)(F)F)n2ncc(C(=O)O)c2N1 |
| InChI | InChI=1S/C17H20F3N3O2/c1-3-5-6-8-11(7-4-2)13-9-14(17(18,19)20)23-15(22-13)12(10-21-23)16(24)25/h4,6-8,10,13-14,22H,2-3,5,9H2,1H3,(H,24,25)/b8-6-,11-7+ |
| InChIKey | HBXRVOOGXIXZCZ-FAWHLJIPSA-N |
| XLogP | 4.34 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|