C16H18F3N3O3 — CID 137203711
5-(4-methoxycyclohepta-3,5-dien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 137203711) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 5-(4-methoxycyclohepta-3,5-dien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 5-(4-methoxycyclohepta-3,5-dien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 137203711 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-(4-methoxycyclohepta-3,5-dien-1-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | COC1=CCC(C2CC(C(F)(F)F)n3ncc(C(=O)O)c3N2)CC=C1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-25-10-4-2-3-9(5-6-10)12-7-13(16(17,18)19)22-14(21-12)11(8-20-22)15(23)24/h2,4,6,8-9,12-13,21H,3,5,7H2,1H3,(H,23,24) |
| InChIKey | CARRGXRJCVQMQF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |