C27H33N5O — CID 137203768
[3-methyl-3-(4-methylphenyl)butanimidoyl] 7,7-dimethyl-5-phenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboximidate (PubChem CID 137203768) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is [3-methyl-3-(4-methylphenyl)butanimidoyl] 7,7-dimethyl-5-phenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboximidate.
| Compound Name | [3-methyl-3-(4-methylphenyl)butanimidoyl] 7,7-dimethyl-5-phenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboximidate |
|---|---|
| PubChem CID | 137203768 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | [3-methyl-3-(4-methylphenyl)butanimidoyl] 7,7-dimethyl-5-phenyl-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboximidate |
| SMILES | [H]/N=C(\O/C(CC(C)(C)c1ccc(C)cc1)=N/[H])c1cnn2c1NC(c1ccccc1)CC2(C)C |
| InChI | InChI=1S/C27H33N5O/c1-18-11-13-20(14-12-18)26(2,3)16-23(28)33-24(29)21-17-30-32-25(21)31-22(15-27(32,4)5)19-9-7-6-8-10-19/h6-14,17,22,28-29,31H,15-16H2,1-5H3/b28-23+,29-24- |
| InChIKey | PLZSPCVYJJBOQI-ABHBNJMISA-N |
| XLogP | 6.17 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|