C14H10Cl2N3O4S+ — CID 137204161
3-(2-chloroacetyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-8-carboxylic acid (PubChem CID 137204161) has the molecular formula C14H10Cl2N3O4S+ and a molecular weight of 387.22 g/mol. Its IUPAC name is 3-(2-chloroacetyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-8-carboxylic acid.
| Compound Name | 3-(2-chloroacetyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-8-carboxylic acid |
|---|---|
| PubChem CID | 137204161 |
| Molecular Formula | C14H10Cl2N3O4S+ |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 3-(2-chloroacetyl)-1-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-hydroxyimidazo[1,2-a]pyridin-1-ium-8-carboxylic acid |
| SMILES | O=C(O)c1cccn2c(C(=O)CCl)c(O)[n+](Cc3cnc(Cl)s3)c12 |
| InChI | InChI=1S/C14H9Cl2N3O4S/c15-4-9(20)10-12(21)19(6-7-5-17-14(16)24-7)11-8(13(22)23)2-1-3-18(10)11/h1-3,5H,4,6H2,(H-,20,21,22,23)/p+1 |
| InChIKey | GMUNQGOXKCGFBP-UHFFFAOYSA-O |
| XLogP | 2.21 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|