About N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide
N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide (PubChem CID 137205460) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide |
| PubChem CID | 137205460 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cn(CC3(C)COC3)nn2)cc(C)c1O |
| InChI | InChI=1S/C16H20N4O3/c1-10-4-12(5-11(2)14(10)21)17-15(22)13-6-20(19-18-13)7-16(3)8-23-9-16/h4-6,21H,7-9H2,1-3H3,(H,17,22) |
| InChIKey | GZUQSTRMDXUANV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide?
The IUPAC name of N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide (CID 137205460) is N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide.
What is the SMILES notation for N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide?
The canonical SMILES for N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide is Cc1cc(NC(=O)c2cn(CC3(C)COC3)nn2)cc(C)c1O.
What is the InChIKey of N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide?
The InChIKey is GZUQSTRMDXUANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O3/c1-10-4-12(5-11(2)14(10)21)17-15(22)13-6-20(19-18-13)7-16(3)8-23-9-16/h4-6,21H,7-9H2,1-3H3,(H,17,22).
What are the key properties of N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide?
N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide has a molecular weight of 316.36 g/mol, XLogP of 1.89, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-hydroxy-3,5-dimethylphenyl)-1-[(3-methyloxetan-3-yl)methyl]triazole-4-carboxamide is sourced from PubChem (CID 137205460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).