C14H19N3O3S — CID 137207319
(3aR,6S,7R,7aR)-5-[(S)-hydroxy(pyridin-3-yl)methyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-thiopyrano[3,2-b]pyrrole-6,7-diol (PubChem CID 137207319) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-5-[(S)-hydroxy(pyridin-3-yl)methyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-thiopyrano[3,2-b]pyrrole-6,7-diol.
| Compound Name | (3aR,6S,7R,7aR)-5-[(S)-hydroxy(pyridin-3-yl)methyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-thiopyrano[3,2-b]pyrrole-6,7-diol |
|---|---|
| PubChem CID | 137207319 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3aR,6S,7R,7aR)-5-[(S)-hydroxy(pyridin-3-yl)methyl]-2-methylimino-3,3a,5,6,7,7a-hexahydro-1H-thiopyrano[3,2-b]pyrrole-6,7-diol |
| SMILES | C/N=C1\C[C@H]2SC([C@@H](O)c3cccnc3)[C@@H](O)[C@H](O)[C@H]2N1 |
| InChI | InChI=1S/C14H19N3O3S/c1-15-9-5-8-10(17-9)12(19)13(20)14(21-8)11(18)7-3-2-4-16-6-7/h2-4,6,8,10-14,18-20H,5H2,1H3,(H,15,17)/t8-,10+,11+,12-,13+,14?/m1/s1 |
| InChIKey | DZMNJJNJPUGWBD-JIGKEEINSA-N |
| XLogP | -0.29 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|