C20H26N7O10PS — CID 137207337
1-[(2R,4R)-5-[[[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 137207337) has the molecular formula C20H26N7O10PS and a molecular weight of 587.51 g/mol. Its IUPAC name is 1-[(2R,4R)-5-[[[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R)-5-[[[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137207337 |
| Molecular Formula | C20H26N7O10PS |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 1-[(2R,4R)-5-[[[(3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphinothioyl]oxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@H](O)C(COP(O)(=S)O[C@@H]3C[C@H](n4cnc5c(=O)[nH]c(N)nc54)OC3CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H26N7O10PS/c1-8-4-26(20(32)25-17(8)30)13-2-9(29)12(36-13)6-34-38(33,39)37-10-3-14(35-11(10)5-28)27-7-22-15-16(27)23-19(21)24-18(15)31/h4,7,9-14,28-29H,2-3,5-6H2,1H3,(H,33,39)(H,25,30,32)(H3,21,23,24,31)/t9-,10-,11?,12?,13-,14-,38?/m1/s1 |
| InChIKey | CWGMLOOOXYCWDS-DSDLOEMMSA-N |
| XLogP | -1.89 |
| TPSA | 242.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|