C25H18N4O3 — CID 137207579
methyl 3-(2,3-dicyano-6-hydroxybenzo[f]quinoxalin-5-yl)-3-(4-methylphenyl)propanoate (PubChem CID 137207579) has the molecular formula C25H18N4O3 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 3-(2,3-dicyano-6-hydroxybenzo[f]quinoxalin-5-yl)-3-(4-methylphenyl)propanoate.
| Compound Name | methyl 3-(2,3-dicyano-6-hydroxybenzo[f]quinoxalin-5-yl)-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 137207579 |
| Molecular Formula | C25H18N4O3 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | methyl 3-(2,3-dicyano-6-hydroxybenzo[f]quinoxalin-5-yl)-3-(4-methylphenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(C)cc1)c1c(O)c2ccccc2c2nc(C#N)c(C#N)nc12 |
| InChI | InChI=1S/C25H18N4O3/c1-14-7-9-15(10-8-14)18(11-21(30)32-2)22-24-23(28-19(12-26)20(13-27)29-24)16-5-3-4-6-17(16)25(22)31/h3-10,18,31H,11H2,1-2H3 |
| InChIKey | GYPUIMPVWHMFSG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|