About 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid
2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 137208528) has the molecular formula C10H7N3O4S
and a molecular weight of 265.25 g/mol. Its IUPAC name is 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 137208528 |
| Molecular Formula | C10H7N3O4S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(/N=N/c2ccc(O)cc2O)n1 |
| InChI | InChI=1S/C10H7N3O4S/c14-5-1-2-6(8(15)3-5)12-13-10-11-7(4-18-10)9(16)17/h1-4,14-15H,(H,16,17)/b13-12+ |
| InChIKey | LNHRFZZAFMKCEC-OUKQBFOZSA-N |
| XLogP | 2.67 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid (CID 137208528) is 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(/N=N/c2ccc(O)cc2O)n1.
What is the InChIKey of 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is LNHRFZZAFMKCEC-OUKQBFOZSA-N. The full InChI is InChI=1S/C10H7N3O4S/c14-5-1-2-6(8(15)3-5)12-13-10-11-7(4-18-10)9(16)17/h1-4,14-15H,(H,16,17)/b13-12+.
What are the key properties of 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid?
2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 265.25 g/mol, XLogP of 2.67, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dihydroxyphenyl)diazenyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 137208528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).