C30H38Fe2 — CID 137209033
5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(5-(2,2-dimethylpropyl)cyclopenta-1,3-diene);bis(iron(2+)) (PubChem CID 137209033) has the molecular formula C30H38Fe2 and a molecular weight of 510.32 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(5-(2,2-dimethylpropyl)cyclopenta-1,3-diene);bis(iron(2+)).
| Compound Name | 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(5-(2,2-dimethylpropyl)cyclopenta-1,3-diene);bis(iron(2+)) |
|---|---|
| PubChem CID | 137209033 |
| Molecular Formula | C30H38Fe2 |
| Molecular Weight | 510.32 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(5-(2,2-dimethylpropyl)cyclopenta-1,3-diene);bis(iron(2+)) |
| SMILES | CC(C)(C)C[c-]1cccc1.CC(C)(C)C[c-]1cccc1.[Fe+2].[Fe+2].c1cc[c-](-[c-]2cccc2)c1 |
| InChI | InChI=1S/C10H8.2C10H15.2Fe/c1-2-6-9(5-1)10-7-3-4-8-10;2*1-10(2,3)8-9-6-4-5-7-9;;/h1-8H;2*4-7H,8H2,1-3H3;;/q-2;2*-1;2*+2 |
| InChIKey | FFSXVMDNMPHISQ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.32 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|