About N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione
N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione (PubChem CID 137209076) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 137209076 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione |
| SMILES | CCC(=O)c1c(O)[nH]c(=O)[nH]c1=O.CN(C)C |
| InChI | InChI=1S/C7H8N2O4.C3H9N/c1-2-3(10)4-5(11)8-7(13)9-6(4)12;1-4(2)3/h2H2,1H3,(H3,8,9,11,12,13);1-3H3 |
| InChIKey | SGXZAWUDSHYTBR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione?
The IUPAC name of N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione (CID 137209076) is N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione is CCC(=O)c1c(O)[nH]c(=O)[nH]c1=O.CN(C)C.
What is the InChIKey of N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione?
The InChIKey is SGXZAWUDSHYTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4.C3H9N/c1-2-3(10)4-5(11)8-7(13)9-6(4)12;1-4(2)3/h2H2,1H3,(H3,8,9,11,12,13);1-3H3.
What are the key properties of N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione?
N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione has a molecular weight of 243.26 g/mol, XLogP of -0.46, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;6-hydroxy-5-propanoyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 137209076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).