About 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine
8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine (PubChem CID 137209088) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine.
Molecular Properties
| Compound Name | 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine |
| PubChem CID | 137209088 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine |
| SMILES | [H]/N=C1/C=C2C=CNC(C)C2C=N1 |
| InChI | InChI=1S/C9H11N3/c1-6-8-5-12-9(10)4-7(8)2-3-11-6/h2-6,8,10-11H,1H3/b10-9- |
| InChIKey | QTWCJLSIWHBFAE-KTKRTIGZSA-N |
| XLogP | 1.10 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine?
The IUPAC name of 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine (CID 137209088) is 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine.
What is the SMILES notation for 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine?
The canonical SMILES for 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine is [H]/N=C1/C=C2C=CNC(C)C2C=N1.
What is the InChIKey of 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine?
The InChIKey is QTWCJLSIWHBFAE-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H11N3/c1-6-8-5-12-9(10)4-7(8)2-3-11-6/h2-6,8,10-11H,1H3/b10-9-.
What are the key properties of 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine?
8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine has a molecular weight of 161.21 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-8,8a-dihydro-7H-2,7-naphthyridin-3-imine is sourced from PubChem (CID 137209088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).