C14H13F3N6 — CID 137209325
N-[(3E)-3-[[1-(3-cyano-1,1,1-trifluoropropan-2-yl)pyrazol-4-yl]methylidene]-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide (PubChem CID 137209325) has the molecular formula C14H13F3N6 and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[(3E)-3-[[1-(3-cyano-1,1,1-trifluoropropan-2-yl)pyrazol-4-yl]methylidene]-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide.
| Compound Name | N-[(3E)-3-[[1-(3-cyano-1,1,1-trifluoropropan-2-yl)pyrazol-4-yl]methylidene]-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 137209325 |
| Molecular Formula | C14H13F3N6 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[(3E)-3-[[1-(3-cyano-1,1,1-trifluoropropan-2-yl)pyrazol-4-yl]methylidene]-1H-pyrrol-2-ylidene]-N'-methylmethanimidamide |
| SMILES | C/N=C/N=C1\NC=C\C1=C/c1cnn(C(CC#N)C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N6/c1-19-9-21-13-11(3-5-20-13)6-10-7-22-23(8-10)12(2-4-18)14(15,16)17/h3,5-9,12H,2H2,1H3,(H,19,20,21)/b11-6+ |
| InChIKey | HAWZCYMTKRVZQQ-IZZDOVSWSA-N |
| XLogP | 2.46 |
| TPSA | 78.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|