C18H19N5O2 — CID 137209538
2-[1-[(1-methyl-6-oxopyrimidin-2-yl)methyl]pyrrolidin-2-yl]-3H-quinazolin-4-one (PubChem CID 137209538) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[1-[(1-methyl-6-oxopyrimidin-2-yl)methyl]pyrrolidin-2-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-[(1-methyl-6-oxopyrimidin-2-yl)methyl]pyrrolidin-2-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137209538 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[1-[(1-methyl-6-oxopyrimidin-2-yl)methyl]pyrrolidin-2-yl]-3H-quinazolin-4-one |
| SMILES | Cn1c(CN2CCCC2c2nc3ccccc3c(=O)[nH]2)nccc1=O |
| InChI | InChI=1S/C18H19N5O2/c1-22-15(19-9-8-16(22)24)11-23-10-4-7-14(23)17-20-13-6-3-2-5-12(13)18(25)21-17/h2-3,5-6,8-9,14H,4,7,10-11H2,1H3,(H,20,21,25) |
| InChIKey | BNGVOVVNBVBJTK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |