C18H16N4O3 — CID 137209673
2-[1-(6-oxo-1H-pyridine-2-carbonyl)pyrrolidin-2-yl]-3H-quinazolin-4-one (PubChem CID 137209673) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-[1-(6-oxo-1H-pyridine-2-carbonyl)pyrrolidin-2-yl]-3H-quinazolin-4-one.
| Compound Name | 2-[1-(6-oxo-1H-pyridine-2-carbonyl)pyrrolidin-2-yl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 137209673 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[1-(6-oxo-1H-pyridine-2-carbonyl)pyrrolidin-2-yl]-3H-quinazolin-4-one |
| SMILES | O=C(c1cccc(=O)[nH]1)N1CCCC1c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H16N4O3/c23-15-9-3-7-13(19-15)18(25)22-10-4-8-14(22)16-20-12-6-2-1-5-11(12)17(24)21-16/h1-3,5-7,9,14H,4,8,10H2,(H,19,23)(H,20,21,24) |
| InChIKey | WDABIVVTQNWPRY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |