About ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate
ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate (PubChem CID 137211374) has the molecular formula C14H15F2NO3
and a molecular weight of 283.27 g/mol. Its IUPAC name is ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate |
| PubChem CID | 137211374 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(C)cc1)=C(/O)C(F)F |
| InChI | InChI=1S/C14H15F2NO3/c1-3-20-14(19)11(12(18)13(15)16)8-17-10-6-4-9(2)5-7-10/h4-8,13,18H,3H2,1-2H3/b12-11+,17-8+ |
| InChIKey | UWBZTDHOAAOAGY-ZOGNCJMKSA-N |
| XLogP | 3.34 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate?
The IUPAC name of ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate (CID 137211374) is ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate.
What is the SMILES notation for ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate?
The canonical SMILES for ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate is CCOC(=O)C(/C=N/c1ccc(C)cc1)=C(/O)C(F)F.
What is the InChIKey of ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate?
The InChIKey is UWBZTDHOAAOAGY-ZOGNCJMKSA-N. The full InChI is InChI=1S/C14H15F2NO3/c1-3-20-14(19)11(12(18)13(15)16)8-17-10-6-4-9(2)5-7-10/h4-8,13,18H,3H2,1-2H3/b12-11+,17-8+.
What are the key properties of ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate?
ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate has a molecular weight of 283.27 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4,4-difluoro-3-hydroxy-2-[(4-methylphenyl)iminomethyl]but-2-enoate is sourced from PubChem (CID 137211374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).