About 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde
2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde (PubChem CID 137212628) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde.
Molecular Properties
| Compound Name | 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde |
| PubChem CID | 137212628 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde |
| SMILES | [H]/N=C1\C=CC=CC1=CC=O |
| InChI | InChI=1S/C8H7NO/c9-8-4-2-1-3-7(8)5-6-10/h1-6,9H/b7-5?,9-8+ |
| InChIKey | PBLKULCYFRNNLW-KQEMPYGNSA-N |
| XLogP | 1.26 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde?
The IUPAC name of 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde (CID 137212628) is 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde.
What is the SMILES notation for 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde?
The canonical SMILES for 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde is [H]/N=C1\C=CC=CC1=CC=O.
What is the InChIKey of 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde?
The InChIKey is PBLKULCYFRNNLW-KQEMPYGNSA-N. The full InChI is InChI=1S/C8H7NO/c9-8-4-2-1-3-7(8)5-6-10/h1-6,9H/b7-5?,9-8+.
What are the key properties of 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde?
2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde has a molecular weight of 133.15 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-iminocyclohexa-2,4-dien-1-ylidene)acetaldehyde is sourced from PubChem (CID 137212628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).