C24H23FN4O3 — CID 137213053
1-benzyl-4-(3-fluorophenyl)imino-6-hydroxy-5-[(4-methoxyphenyl)methyl]-1,3,5-triazinan-2-one (PubChem CID 137213053) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is 1-benzyl-4-(3-fluorophenyl)imino-6-hydroxy-5-[(4-methoxyphenyl)methyl]-1,3,5-triazinan-2-one.
| Compound Name | 1-benzyl-4-(3-fluorophenyl)imino-6-hydroxy-5-[(4-methoxyphenyl)methyl]-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 137213053 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-benzyl-4-(3-fluorophenyl)imino-6-hydroxy-5-[(4-methoxyphenyl)methyl]-1,3,5-triazinan-2-one |
| SMILES | COc1ccc(CN2/C(=N/c3cccc(F)c3)NC(=O)N(Cc3ccccc3)C2O)cc1 |
| InChI | InChI=1S/C24H23FN4O3/c1-32-21-12-10-18(11-13-21)15-28-22(26-20-9-5-8-19(25)14-20)27-23(30)29(24(28)31)16-17-6-3-2-4-7-17/h2-14,24,31H,15-16H2,1H3,(H,26,27,30) |
| InChIKey | UFNLCYLKOJEFJV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|