C10H11F3N4 — CID 137213262
(2Z,4E)-N-methyl-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine (PubChem CID 137213262) has the molecular formula C10H11F3N4 and a molecular weight of 244.22 g/mol. Its IUPAC name is (2Z,4E)-N-methyl-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-N-methyl-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 137213262 |
| Molecular Formula | C10H11F3N4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (2Z,4E)-N-methyl-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]hexa-2,4-dien-1-imine |
| SMILES | C/N=C/C=C\C=C(/C)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N4/c1-7(5-3-4-6-14-2)8-15-9(17-16-8)10(11,12)13/h3-6H,1-2H3,(H,15,16,17)/b4-3-,7-5+,14-6+ |
| InChIKey | HWSVSMFELYJZBH-GPQVKKIPSA-N |
| XLogP | 2.48 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|